C18H26N2O — CID 166367359
4-[(4-cyclohexylphenyl)methyl]-3-methylpiperazin-2-one (PubChem CID 166367359) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is 4-[(4-cyclohexylphenyl)methyl]-3-methylpiperazin-2-one.
| Compound Name | 4-[(4-cyclohexylphenyl)methyl]-3-methylpiperazin-2-one |
|---|---|
| PubChem CID | 166367359 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 4-[(4-cyclohexylphenyl)methyl]-3-methylpiperazin-2-one |
| SMILES | CC1C(=O)NCCN1Cc1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C18H26N2O/c1-14-18(21)19-11-12-20(14)13-15-7-9-17(10-8-15)16-5-3-2-4-6-16/h7-10,14,16H,2-6,11-13H2,1H3,(H,19,21) |
| InChIKey | FBHSSFSFTLXINC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |