C17H20IN3O — CID 166367428
3-[[methyl-(5-phenyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]phenol;hydroiodide (PubChem CID 166367428) has the molecular formula C17H20IN3O and a molecular weight of 409.27 g/mol. Its IUPAC name is 3-[[methyl-(5-phenyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]phenol;hydroiodide.
| Compound Name | 3-[[methyl-(5-phenyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]phenol;hydroiodide |
|---|---|
| PubChem CID | 166367428 |
| Molecular Formula | C17H20IN3O |
| Molecular Weight | 409.27 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 3-[[methyl-(5-phenyl-4,5-dihydro-1H-imidazol-2-yl)amino]methyl]phenol;hydroiodide |
| SMILES | CN(Cc1cccc(O)c1)C1=NCC(c2ccccc2)N1.I |
| InChI | InChI=1S/C17H19N3O.HI/c1-20(12-13-6-5-9-15(21)10-13)17-18-11-16(19-17)14-7-3-2-4-8-14;/h2-10,16,21H,11-12H2,1H3,(H,18,19);1H |
| InChIKey | DMGZSYKSMCYDQX-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|