C15H17BrIN3S — CID 166367161
N-[(5-bromothiophen-3-yl)methyl]-N-methyl-5-phenyl-4,5-dihydro-1H-imidazol-2-amine;hydroiodide (PubChem CID 166367161) has the molecular formula C15H17BrIN3S and a molecular weight of 478.20 g/mol. Its IUPAC name is N-[(5-bromothiophen-3-yl)methyl]-N-methyl-5-phenyl-4,5-dihydro-1H-imidazol-2-amine;hydroiodide.
| Compound Name | N-[(5-bromothiophen-3-yl)methyl]-N-methyl-5-phenyl-4,5-dihydro-1H-imidazol-2-amine;hydroiodide |
|---|---|
| PubChem CID | 166367161 |
| Molecular Formula | C15H17BrIN3S |
| Molecular Weight | 478.20 g/mol |
| Exact Mass | 476.94 |
| IUPAC Name | N-[(5-bromothiophen-3-yl)methyl]-N-methyl-5-phenyl-4,5-dihydro-1H-imidazol-2-amine;hydroiodide |
| SMILES | CN(Cc1csc(Br)c1)C1=NCC(c2ccccc2)N1.I |
| InChI | InChI=1S/C15H16BrN3S.HI/c1-19(9-11-7-14(16)20-10-11)15-17-8-13(18-15)12-5-3-2-4-6-12;/h2-7,10,13H,8-9H2,1H3,(H,17,18);1H |
| InChIKey | RTNAPKNVGQPLTQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.20 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|