C21H18N4O3S — CID 16636931
(5Z)-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-5-[(2-hydroxyphenyl)methylidene]-2-imino-1,3-thiazolidin-4-one (PubChem CID 16636931) has the molecular formula C21H18N4O3S and a molecular weight of 406.47 g/mol. Its IUPAC name is (5Z)-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-5-[(2-hydroxyphenyl)methylidene]-2-imino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-5-[(2-hydroxyphenyl)methylidene]-2-imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 16636931 |
| Molecular Formula | C21H18N4O3S |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | (5Z)-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-5-[(2-hydroxyphenyl)methylidene]-2-imino-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\S/C(=C\c2ccccc2O)C(=O)N1c1c(C)n(C)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C21H18N4O3S/c1-13-18(20(28)25(23(13)2)15-9-4-3-5-10-15)24-19(27)17(29-21(24)22)12-14-8-6-7-11-16(14)26/h3-12,22,26H,1-2H3/b17-12-,22-21- |
| InChIKey | NWFMEPBXRMSKEO-JNJIEWIHSA-N |
| XLogP | 3.25 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|