C19H16BrF2NO5S — CID 166369752
N-(3-bromo-4,5-difluorophenyl)sulfonyl-2-[(1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl)oxy]acetamide (PubChem CID 166369752) has the molecular formula C19H16BrF2NO5S and a molecular weight of 488.31 g/mol. Its IUPAC name is N-(3-bromo-4,5-difluorophenyl)sulfonyl-2-[(1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl)oxy]acetamide.
| Compound Name | N-(3-bromo-4,5-difluorophenyl)sulfonyl-2-[(1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl)oxy]acetamide |
|---|---|
| PubChem CID | 166369752 |
| Molecular Formula | C19H16BrF2NO5S |
| Molecular Weight | 488.31 g/mol |
| Exact Mass | 486.99 |
| IUPAC Name | N-(3-bromo-4,5-difluorophenyl)sulfonyl-2-[(1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl)oxy]acetamide |
| SMILES | Cc1ccc(OCC(=O)NS(=O)(=O)c2cc(F)c(F)c(Br)c2)c2c1C(C)CC2=O |
| InChI | InChI=1S/C19H16BrF2NO5S/c1-9-3-4-15(18-14(24)5-10(2)17(9)18)28-8-16(25)23-29(26,27)11-6-12(20)19(22)13(21)7-11/h3-4,6-7,10H,5,8H2,1-2H3,(H,23,25) |
| InChIKey | CXELIVDJSTWLIX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.31 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|