C15H14FN5O2S — CID 166371798
4-fluoro-3-[5-(1H-imidazol-2-ylmethylamino)-3-pyridinyl]benzenesulfonamide (PubChem CID 166371798) has the molecular formula C15H14FN5O2S and a molecular weight of 347.38 g/mol. Its IUPAC name is 4-fluoro-3-[5-(1H-imidazol-2-ylmethylamino)-3-pyridinyl]benzenesulfonamide.
| Compound Name | 4-fluoro-3-[5-(1H-imidazol-2-ylmethylamino)-3-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 166371798 |
| Molecular Formula | C15H14FN5O2S |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 4-fluoro-3-[5-(1H-imidazol-2-ylmethylamino)-3-pyridinyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(F)c(-c2cncc(NCc3ncc[nH]3)c2)c1 |
| InChI | InChI=1S/C15H14FN5O2S/c16-14-2-1-12(24(17,22)23)6-13(14)10-5-11(8-18-7-10)21-9-15-19-3-4-20-15/h1-8,21H,9H2,(H,19,20)(H2,17,22,23) |
| InChIKey | KOYOTRIVGCOHIF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |