C10H11FN4 — CID 64547692
3-fluoro-1-N-(1H-imidazol-2-ylmethyl)benzene-1,2-diamine (PubChem CID 64547692) has the molecular formula C10H11FN4 and a molecular weight of 206.22 g/mol. Its IUPAC name is 3-fluoro-1-N-(1H-imidazol-2-ylmethyl)benzene-1,2-diamine.
| Compound Name | 3-fluoro-1-N-(1H-imidazol-2-ylmethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 64547692 |
| Molecular Formula | C10H11FN4 |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | 3-fluoro-1-N-(1H-imidazol-2-ylmethyl)benzene-1,2-diamine |
| SMILES | Nc1c(F)cccc1NCc1ncc[nH]1 |
| InChI | InChI=1S/C10H11FN4/c11-7-2-1-3-8(10(7)12)15-6-9-13-4-5-14-9/h1-5,15H,6,12H2,(H,13,14) |
| InChIKey | JTRWNUMUEFOWKN-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|