C16H12ClF3N4 — CID 166397915
3-chloro-N-(1H-imidazol-2-ylmethyl)-4-[5-(trifluoromethyl)-3-pyridinyl]aniline (PubChem CID 166397915) has the molecular formula C16H12ClF3N4 and a molecular weight of 352.75 g/mol. Its IUPAC name is 3-chloro-N-(1H-imidazol-2-ylmethyl)-4-[5-(trifluoromethyl)-3-pyridinyl]aniline.
| Compound Name | 3-chloro-N-(1H-imidazol-2-ylmethyl)-4-[5-(trifluoromethyl)-3-pyridinyl]aniline |
|---|---|
| PubChem CID | 166397915 |
| Molecular Formula | C16H12ClF3N4 |
| Molecular Weight | 352.75 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 3-chloro-N-(1H-imidazol-2-ylmethyl)-4-[5-(trifluoromethyl)-3-pyridinyl]aniline |
| SMILES | FC(F)(F)c1cncc(-c2ccc(NCc3ncc[nH]3)cc2Cl)c1 |
| InChI | InChI=1S/C16H12ClF3N4/c17-14-6-12(24-9-15-22-3-4-23-15)1-2-13(14)10-5-11(8-21-7-10)16(18,19)20/h1-8,24H,9H2,(H,22,23) |
| InChIKey | SVHOMYMIQARWDP-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.75 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |