C10H8Cl2FN3 — CID 83076307
2,6-dichloro-4-fluoro-N-(1H-imidazol-2-ylmethyl)aniline (PubChem CID 83076307) has the molecular formula C10H8Cl2FN3 and a molecular weight of 260.10 g/mol. Its IUPAC name is 2,6-dichloro-4-fluoro-N-(1H-imidazol-2-ylmethyl)aniline.
| Compound Name | 2,6-dichloro-4-fluoro-N-(1H-imidazol-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 83076307 |
| Molecular Formula | C10H8Cl2FN3 |
| Molecular Weight | 260.10 g/mol |
| Exact Mass | 259.01 |
| IUPAC Name | 2,6-dichloro-4-fluoro-N-(1H-imidazol-2-ylmethyl)aniline |
| SMILES | Fc1cc(Cl)c(NCc2ncc[nH]2)c(Cl)c1 |
| InChI | InChI=1S/C10H8Cl2FN3/c11-7-3-6(13)4-8(12)10(7)16-5-9-14-1-2-15-9/h1-4,16H,5H2,(H,14,15) |
| InChIKey | MJOOFMZXYBLLIU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.10 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |