C11H8Cl2FN3 — CID 83078218
2,6-dichloro-4-fluoro-N-(pyrimidin-2-ylmethyl)aniline (PubChem CID 83078218) has the molecular formula C11H8Cl2FN3 and a molecular weight of 272.11 g/mol. Its IUPAC name is 2,6-dichloro-4-fluoro-N-(pyrimidin-2-ylmethyl)aniline.
| Compound Name | 2,6-dichloro-4-fluoro-N-(pyrimidin-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 83078218 |
| Molecular Formula | C11H8Cl2FN3 |
| Molecular Weight | 272.11 g/mol |
| Exact Mass | 271.01 |
| IUPAC Name | 2,6-dichloro-4-fluoro-N-(pyrimidin-2-ylmethyl)aniline |
| SMILES | Fc1cc(Cl)c(NCc2ncccn2)c(Cl)c1 |
| InChI | InChI=1S/C11H8Cl2FN3/c12-8-4-7(14)5-9(13)11(8)17-6-10-15-2-1-3-16-10/h1-5,17H,6H2 |
| InChIKey | VSJPNSNLIXSHCI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.11 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |