C11H8BrF2N3 — CID 65469563
4-bromo-2,6-difluoro-N-(pyrimidin-2-ylmethyl)aniline (PubChem CID 65469563) has the molecular formula C11H8BrF2N3 and a molecular weight of 300.11 g/mol. Its IUPAC name is 4-bromo-2,6-difluoro-N-(pyrimidin-2-ylmethyl)aniline.
| Compound Name | 4-bromo-2,6-difluoro-N-(pyrimidin-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 65469563 |
| Molecular Formula | C11H8BrF2N3 |
| Molecular Weight | 300.11 g/mol |
| Exact Mass | 298.99 |
| IUPAC Name | 4-bromo-2,6-difluoro-N-(pyrimidin-2-ylmethyl)aniline |
| SMILES | Fc1cc(Br)cc(F)c1NCc1ncccn1 |
| InChI | InChI=1S/C11H8BrF2N3/c12-7-4-8(13)11(9(14)5-7)17-6-10-15-2-1-3-16-10/h1-5,17H,6H2 |
| InChIKey | WPFYDSQDDCMQIK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.11 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |