C9H9ClN4 — CID 64531503
3-chloro-N-(1H-imidazol-2-ylmethyl)pyridin-2-amine (PubChem CID 64531503) has the molecular formula C9H9ClN4 and a molecular weight of 208.65 g/mol. Its IUPAC name is 3-chloro-N-(1H-imidazol-2-ylmethyl)pyridin-2-amine.
| Compound Name | 3-chloro-N-(1H-imidazol-2-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 64531503 |
| Molecular Formula | C9H9ClN4 |
| Molecular Weight | 208.65 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 3-chloro-N-(1H-imidazol-2-ylmethyl)pyridin-2-amine |
| SMILES | Clc1cccnc1NCc1ncc[nH]1 |
| InChI | InChI=1S/C9H9ClN4/c10-7-2-1-3-13-9(7)14-6-8-11-4-5-12-8/h1-5H,6H2,(H,11,12)(H,13,14) |
| InChIKey | JWZIHSGEYBGNFK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.65 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |