C12H15F3N2O2 — CID 16637629
3-cyclohexa-2,5-dien-1-yl-N-methyl-2-[(2,2,2-trifluoroacetyl)amino]propanamide (PubChem CID 16637629) has the molecular formula C12H15F3N2O2 and a molecular weight of 276.26 g/mol. Its IUPAC name is 3-cyclohexa-2,5-dien-1-yl-N-methyl-2-[(2,2,2-trifluoroacetyl)amino]propanamide.
| Compound Name | 3-cyclohexa-2,5-dien-1-yl-N-methyl-2-[(2,2,2-trifluoroacetyl)amino]propanamide |
|---|---|
| PubChem CID | 16637629 |
| Molecular Formula | C12H15F3N2O2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 3-cyclohexa-2,5-dien-1-yl-N-methyl-2-[(2,2,2-trifluoroacetyl)amino]propanamide |
| SMILES | CNC(=O)C(CC1C=CCC=C1)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C12H15F3N2O2/c1-16-10(18)9(17-11(19)12(13,14)15)7-8-5-3-2-4-6-8/h3-6,8-9H,2,7H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | XPCYOFJRXYLJSF-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|