C21H23N5O3 — CID 166376614
N-[3-[3-(carbamoylamino)butanoylamino]phenyl]-1-methylindole-2-carboxamide (PubChem CID 166376614) has the molecular formula C21H23N5O3 and a molecular weight of 393.45 g/mol. Its IUPAC name is N-[3-[3-(carbamoylamino)butanoylamino]phenyl]-1-methylindole-2-carboxamide.
| Compound Name | N-[3-[3-(carbamoylamino)butanoylamino]phenyl]-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 166376614 |
| Molecular Formula | C21H23N5O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | N-[3-[3-(carbamoylamino)butanoylamino]phenyl]-1-methylindole-2-carboxamide |
| SMILES | CC(CC(=O)Nc1cccc(NC(=O)c2cc3ccccc3n2C)c1)NC(N)=O |
| InChI | InChI=1S/C21H23N5O3/c1-13(23-21(22)29)10-19(27)24-15-7-5-8-16(12-15)25-20(28)18-11-14-6-3-4-9-17(14)26(18)2/h3-9,11-13H,10H2,1-2H3,(H,24,27)(H,25,28)(H3,22,23,29) |
| InChIKey | GBVGAGSLECPWEL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 118.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |