C20H26N6O5 — CID 86583995
N-[(2S)-1-[[(2S)-4-(2-carbamoylhydrazinyl)-1,4-dioxobutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-1-methylindole-2-carboxamide (PubChem CID 86583995) has the molecular formula C20H26N6O5 and a molecular weight of 430.47 g/mol. Its IUPAC name is N-[(2S)-1-[[(2S)-4-(2-carbamoylhydrazinyl)-1,4-dioxobutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-1-methylindole-2-carboxamide.
| Compound Name | N-[(2S)-1-[[(2S)-4-(2-carbamoylhydrazinyl)-1,4-dioxobutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 86583995 |
| Molecular Formula | C20H26N6O5 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | N-[(2S)-1-[[(2S)-4-(2-carbamoylhydrazinyl)-1,4-dioxobutan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]-1-methylindole-2-carboxamide |
| SMILES | CC(C)[C@H](NC(=O)c1cc2ccccc2n1C)C(=O)N[C@H](C=O)CC(=O)NNC(N)=O |
| InChI | InChI=1S/C20H26N6O5/c1-11(2)17(19(30)22-13(10-27)9-16(28)24-25-20(21)31)23-18(29)15-8-12-6-4-5-7-14(12)26(15)3/h4-8,10-11,13,17H,9H2,1-3H3,(H,22,30)(H,23,29)(H,24,28)(H3,21,25,31)/t13-,17-/m0/s1 |
| InChIKey | SMOAVRFWHRNBHP-GUYCJALGSA-N |
| XLogP | -0.29 |
| TPSA | 164.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|