C24H34N6O5 — CID 86583993
tert-butyl (3S)-N-carbamoyl-3-[[(2S)-3-methyl-2-[(1-methylindole-2-carbonyl)amino]butanoyl]amino]-4-oxobutanehydrazonate (PubChem CID 86583993) has the molecular formula C24H34N6O5 and a molecular weight of 486.57 g/mol. Its IUPAC name is tert-butyl (3S)-N-carbamoyl-3-[[(2S)-3-methyl-2-[(1-methylindole-2-carbonyl)amino]butanoyl]amino]-4-oxobutanehydrazonate.
| Compound Name | tert-butyl (3S)-N-carbamoyl-3-[[(2S)-3-methyl-2-[(1-methylindole-2-carbonyl)amino]butanoyl]amino]-4-oxobutanehydrazonate |
|---|---|
| PubChem CID | 86583993 |
| Molecular Formula | C24H34N6O5 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | tert-butyl (3S)-N-carbamoyl-3-[[(2S)-3-methyl-2-[(1-methylindole-2-carbonyl)amino]butanoyl]amino]-4-oxobutanehydrazonate |
| SMILES | CC(C)[C@H](NC(=O)c1cc2ccccc2n1C)C(=O)N[C@H](C=O)CC(=NNC(N)=O)OC(C)(C)C |
| InChI | InChI=1S/C24H34N6O5/c1-14(2)20(27-21(32)18-11-15-9-7-8-10-17(15)30(18)6)22(33)26-16(13-31)12-19(28-29-23(25)34)35-24(3,4)5/h7-11,13-14,16,20H,12H2,1-6H3,(H,26,33)(H,27,32)(H3,25,29,34)/t16-,20-/m0/s1 |
| InChIKey | AVCKGXHPWKIBKL-JXFKEZNVSA-N |
| XLogP | 1.80 |
| TPSA | 156.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|