C27H38N6O5 — CID 86585452
tert-butyl (3S)-N-carbamoyl-3-[[(2S)-4-methyl-2-[[2-(naphthalen-1-ylamino)acetyl]amino]pentanoyl]amino]-4-oxobutanehydrazonate (PubChem CID 86585452) has the molecular formula C27H38N6O5 and a molecular weight of 526.64 g/mol. Its IUPAC name is tert-butyl (3S)-N-carbamoyl-3-[[(2S)-4-methyl-2-[[2-(naphthalen-1-ylamino)acetyl]amino]pentanoyl]amino]-4-oxobutanehydrazonate.
| Compound Name | tert-butyl (3S)-N-carbamoyl-3-[[(2S)-4-methyl-2-[[2-(naphthalen-1-ylamino)acetyl]amino]pentanoyl]amino]-4-oxobutanehydrazonate |
|---|---|
| PubChem CID | 86585452 |
| Molecular Formula | C27H38N6O5 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.29 |
| IUPAC Name | tert-butyl (3S)-N-carbamoyl-3-[[(2S)-4-methyl-2-[[2-(naphthalen-1-ylamino)acetyl]amino]pentanoyl]amino]-4-oxobutanehydrazonate |
| SMILES | CC(C)C[C@H](NC(=O)CNc1cccc2ccccc12)C(=O)N[C@H](C=O)CC(=NNC(N)=O)OC(C)(C)C |
| InChI | InChI=1S/C27H38N6O5/c1-17(2)13-22(31-23(35)15-29-21-12-8-10-18-9-6-7-11-20(18)21)25(36)30-19(16-34)14-24(32-33-26(28)37)38-27(3,4)5/h6-12,16-17,19,22,29H,13-15H2,1-5H3,(H,30,36)(H,31,35)(H3,28,33,37)/t19-,22-/m0/s1 |
| InChIKey | PVFZWGBXIVWNKE-UGKGYDQZSA-N |
| XLogP | 2.65 |
| TPSA | 164.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|