C21H30N2O3S — CID 156791374
tert-butyl carbamate;4-methyl-N-naphthalen-1-ylsulfanylpentanamide (PubChem CID 156791374) has the molecular formula C21H30N2O3S and a molecular weight of 390.55 g/mol. Its IUPAC name is tert-butyl carbamate;4-methyl-N-naphthalen-1-ylsulfanylpentanamide.
| Compound Name | tert-butyl carbamate;4-methyl-N-naphthalen-1-ylsulfanylpentanamide |
|---|---|
| PubChem CID | 156791374 |
| Molecular Formula | C21H30N2O3S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | tert-butyl carbamate;4-methyl-N-naphthalen-1-ylsulfanylpentanamide |
| SMILES | CC(C)(C)OC(N)=O.CC(C)CCC(=O)NSc1cccc2ccccc12 |
| InChI | InChI=1S/C16H19NOS.C5H11NO2/c1-12(2)10-11-16(18)17-19-15-9-5-7-13-6-3-4-8-14(13)15;1-5(2,3)8-4(6)7/h3-9,12H,10-11H2,1-2H3,(H,17,18);1-3H3,(H2,6,7) |
| InChIKey | KCXUMAVPIWWPJC-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|