C23H31ClN2O4S — CID 156791382
tert-butyl carbamate;N-[3-(4-chlorophenoxy)phenyl]sulfanyl-4-methylpentanamide (PubChem CID 156791382) has the molecular formula C23H31ClN2O4S and a molecular weight of 467.03 g/mol. Its IUPAC name is tert-butyl carbamate;N-[3-(4-chlorophenoxy)phenyl]sulfanyl-4-methylpentanamide.
| Compound Name | tert-butyl carbamate;N-[3-(4-chlorophenoxy)phenyl]sulfanyl-4-methylpentanamide |
|---|---|
| PubChem CID | 156791382 |
| Molecular Formula | C23H31ClN2O4S |
| Molecular Weight | 467.03 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | tert-butyl carbamate;N-[3-(4-chlorophenoxy)phenyl]sulfanyl-4-methylpentanamide |
| SMILES | CC(C)(C)OC(N)=O.CC(C)CCC(=O)NSc1cccc(Oc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C18H20ClNO2S.C5H11NO2/c1-13(2)6-11-18(21)20-23-17-5-3-4-16(12-17)22-15-9-7-14(19)8-10-15;1-5(2,3)8-4(6)7/h3-5,7-10,12-13H,6,11H2,1-2H3,(H,20,21);1-3H3,(H2,6,7) |
| InChIKey | QPUUYKQPPKXGOY-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.03 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|