C28H34N6O5 — CID 86584000
tert-butyl (3S)-3-[[(2S)-2-[(1-benzylindole-2-carbonyl)amino]propanoyl]amino]-N-carbamoyl-4-oxobutanehydrazonate (PubChem CID 86584000) has the molecular formula C28H34N6O5 and a molecular weight of 534.62 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[(2S)-2-[(1-benzylindole-2-carbonyl)amino]propanoyl]amino]-N-carbamoyl-4-oxobutanehydrazonate.
| Compound Name | tert-butyl (3S)-3-[[(2S)-2-[(1-benzylindole-2-carbonyl)amino]propanoyl]amino]-N-carbamoyl-4-oxobutanehydrazonate |
|---|---|
| PubChem CID | 86584000 |
| Molecular Formula | C28H34N6O5 |
| Molecular Weight | 534.62 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | tert-butyl (3S)-3-[[(2S)-2-[(1-benzylindole-2-carbonyl)amino]propanoyl]amino]-N-carbamoyl-4-oxobutanehydrazonate |
| SMILES | C[C@H](NC(=O)c1cc2ccccc2n1Cc1ccccc1)C(=O)N[C@H](C=O)CC(=NNC(N)=O)OC(C)(C)C |
| InChI | InChI=1S/C28H34N6O5/c1-18(25(36)31-21(17-35)15-24(32-33-27(29)38)39-28(2,3)4)30-26(37)23-14-20-12-8-9-13-22(20)34(23)16-19-10-6-5-7-11-19/h5-14,17-18,21H,15-16H2,1-4H3,(H,30,37)(H,31,36)(H3,29,33,38)/t18-,21-/m0/s1 |
| InChIKey | KTMKUBLVZKHWMD-RXVVDRJESA-N |
| XLogP | 2.68 |
| TPSA | 156.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.62 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|