C24H22N4O — CID 27876412
N-[(E)-1-(4-aminophenyl)ethylideneamino]-1-benzylindole-2-carboxamide (PubChem CID 27876412) has the molecular formula C24H22N4O and a molecular weight of 382.47 g/mol. Its IUPAC name is N-[(E)-1-(4-aminophenyl)ethylideneamino]-1-benzylindole-2-carboxamide.
| Compound Name | N-[(E)-1-(4-aminophenyl)ethylideneamino]-1-benzylindole-2-carboxamide |
|---|---|
| PubChem CID | 27876412 |
| Molecular Formula | C24H22N4O |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | N-[(E)-1-(4-aminophenyl)ethylideneamino]-1-benzylindole-2-carboxamide |
| SMILES | C/C(=N\NC(=O)c1cc2ccccc2n1Cc1ccccc1)c1ccc(N)cc1 |
| InChI | InChI=1S/C24H22N4O/c1-17(19-11-13-21(25)14-12-19)26-27-24(29)23-15-20-9-5-6-10-22(20)28(23)16-18-7-3-2-4-8-18/h2-15H,16,25H2,1H3,(H,27,29)/b26-17+ |
| InChIKey | ODLQFXDFUAFDQS-YZSQISJMSA-N |
| XLogP | 4.43 |
| TPSA | 72.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_anil(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|