C23H19N3O3 — CID 135882965
1-benzyl-N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]indole-2-carboxamide (PubChem CID 135882965) has the molecular formula C23H19N3O3 and a molecular weight of 385.42 g/mol. Its IUPAC name is 1-benzyl-N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]indole-2-carboxamide.
| Compound Name | 1-benzyl-N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]indole-2-carboxamide |
|---|---|
| PubChem CID | 135882965 |
| Molecular Formula | C23H19N3O3 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 1-benzyl-N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]indole-2-carboxamide |
| SMILES | O=C(N/N=C/c1ccc(O)cc1O)c1cc2ccccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C23H19N3O3/c27-19-11-10-18(22(28)13-19)14-24-25-23(29)21-12-17-8-4-5-9-20(17)26(21)15-16-6-2-1-3-7-16/h1-14,27-28H,15H2,(H,25,29)/b24-14+ |
| InChIKey | YLXGCJGGQHFARZ-ZVHZXABRSA-N |
| XLogP | 3.86 |
| TPSA | 86.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|