C18H20N4O4 — CID 16637680
(2S,3S,4S,5E,6Z)-2-(hydroxymethyl)-5,6-bis(phenylhydrazinylidene)oxane-3,4-diol (PubChem CID 16637680) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is (2S,3S,4S,5E,6Z)-2-(hydroxymethyl)-5,6-bis(phenylhydrazinylidene)oxane-3,4-diol.
| Compound Name | (2S,3S,4S,5E,6Z)-2-(hydroxymethyl)-5,6-bis(phenylhydrazinylidene)oxane-3,4-diol |
|---|---|
| PubChem CID | 16637680 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | (2S,3S,4S,5E,6Z)-2-(hydroxymethyl)-5,6-bis(phenylhydrazinylidene)oxane-3,4-diol |
| SMILES | OC[C@@H]1OC(=N\Nc2ccccc2)/C(=N/Nc2ccccc2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H20N4O4/c23-11-14-16(24)17(25)15(21-19-12-7-3-1-4-8-12)18(26-14)22-20-13-9-5-2-6-10-13/h1-10,14,16-17,19-20,23-25H,11H2/b21-15+,22-18-/t14-,16+,17-/m0/s1 |
| InChIKey | IJSHSQIAXMECND-ZBAATXEJSA-N |
| XLogP | 0.99 |
| TPSA | 118.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|