C19H20N4O4 — CID 51055766
(2S,3Z,5E,6S)-2-(hydroxymethyl)-6-methoxy-3,5-bis(phenylhydrazinylidene)oxan-4-one (PubChem CID 51055766) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is (2S,3Z,5E,6S)-2-(hydroxymethyl)-6-methoxy-3,5-bis(phenylhydrazinylidene)oxan-4-one.
| Compound Name | (2S,3Z,5E,6S)-2-(hydroxymethyl)-6-methoxy-3,5-bis(phenylhydrazinylidene)oxan-4-one |
|---|---|
| PubChem CID | 51055766 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | (2S,3Z,5E,6S)-2-(hydroxymethyl)-6-methoxy-3,5-bis(phenylhydrazinylidene)oxan-4-one |
| SMILES | CO[C@H]1O[C@H](CO)/C(=N/Nc2ccccc2)C(=O)/C1=N/Nc1ccccc1 |
| InChI | InChI=1S/C19H20N4O4/c1-26-19-17(23-21-14-10-6-3-7-11-14)18(25)16(15(12-24)27-19)22-20-13-8-4-2-5-9-13/h2-11,15,19-21,24H,12H2,1H3/b22-16-,23-17-/t15-,19+/m1/s1 |
| InChIKey | WMTXRYNWOMLAOZ-SBTGARBISA-N |
| XLogP | 1.86 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|