C18H18N4O4 — CID 51562676
(3E,4E,5R)-5-[(1S)-1,2-dihydroxyethyl]-3,4-bis(phenylhydrazinylidene)oxolan-2-one (PubChem CID 51562676) has the molecular formula C18H18N4O4 and a molecular weight of 354.37 g/mol. Its IUPAC name is (3E,4E,5R)-5-[(1S)-1,2-dihydroxyethyl]-3,4-bis(phenylhydrazinylidene)oxolan-2-one.
| Compound Name | (3E,4E,5R)-5-[(1S)-1,2-dihydroxyethyl]-3,4-bis(phenylhydrazinylidene)oxolan-2-one |
|---|---|
| PubChem CID | 51562676 |
| Molecular Formula | C18H18N4O4 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | (3E,4E,5R)-5-[(1S)-1,2-dihydroxyethyl]-3,4-bis(phenylhydrazinylidene)oxolan-2-one |
| SMILES | O=C1O[C@@H]([C@@H](O)CO)C(=N/Nc2ccccc2)/C1=N\Nc1ccccc1 |
| InChI | InChI=1S/C18H18N4O4/c23-11-14(24)17-15(21-19-12-7-3-1-4-8-12)16(18(25)26-17)22-20-13-9-5-2-6-10-13/h1-10,14,17,19-20,23-24H,11H2/b21-15+,22-16+/t14-,17-/m0/s1 |
| InChIKey | ICUCZGSBSNDYDE-WMSQEKLGSA-N |
| XLogP | 1.20 |
| TPSA | 115.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|