C6H9N3O5 — CID 144865736
(3E,4Z)-5-(1,2-dihydroxyethyl)-3-hydrazinylidene-4-hydroxyiminooxolan-2-one (PubChem CID 144865736) has the molecular formula C6H9N3O5 and a molecular weight of 203.15 g/mol. Its IUPAC name is (3E,4Z)-5-(1,2-dihydroxyethyl)-3-hydrazinylidene-4-hydroxyiminooxolan-2-one.
| Compound Name | (3E,4Z)-5-(1,2-dihydroxyethyl)-3-hydrazinylidene-4-hydroxyiminooxolan-2-one |
|---|---|
| PubChem CID | 144865736 |
| Molecular Formula | C6H9N3O5 |
| Molecular Weight | 203.15 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | (3E,4Z)-5-(1,2-dihydroxyethyl)-3-hydrazinylidene-4-hydroxyiminooxolan-2-one |
| SMILES | N/N=C1/C(=O)OC(C(O)CO)/C1=N\O |
| InChI | InChI=1S/C6H9N3O5/c7-8-4-3(9-13)5(2(11)1-10)14-6(4)12/h2,5,10-11,13H,1,7H2/b8-4+,9-3- |
| InChIKey | MSNPPBUAFGXUGB-BTFXIVTBSA-N |
| XLogP | -2.59 |
| TPSA | 137.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.15 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|