C6H7NO6 — CID 174087762
(5R)-5-[(1R)-1,2-dihydroxyethyl]-4-hydroxyiminooxolane-2,3-dione (PubChem CID 174087762) has the molecular formula C6H7NO6 and a molecular weight of 189.12 g/mol. Its IUPAC name is (5R)-5-[(1R)-1,2-dihydroxyethyl]-4-hydroxyiminooxolane-2,3-dione.
| Compound Name | (5R)-5-[(1R)-1,2-dihydroxyethyl]-4-hydroxyiminooxolane-2,3-dione |
|---|---|
| PubChem CID | 174087762 |
| Molecular Formula | C6H7NO6 |
| Molecular Weight | 189.12 g/mol |
| Exact Mass | 189.03 |
| IUPAC Name | (5R)-5-[(1R)-1,2-dihydroxyethyl]-4-hydroxyiminooxolane-2,3-dione |
| SMILES | O=C1O[C@@H]([C@H](O)CO)C(=NO)C1=O |
| InChI | InChI=1S/C6H7NO6/c8-1-2(9)5-3(7-12)4(10)6(11)13-5/h2,5,8-9,12H,1H2/t2-,5+/m1/s1 |
| InChIKey | CFUQZCKHHBDCOT-MVHIGOERSA-N |
| XLogP | -2.34 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.12 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|