C22H19N5O — CID 92641131
N-[(E)-[(2S,4E)-5-imino-2-phenyl-4-(phenylhydrazinylidene)oxolan-3-ylidene]amino]aniline (PubChem CID 92641131) has the molecular formula C22H19N5O and a molecular weight of 369.43 g/mol. Its IUPAC name is N-[(E)-[(2S,4E)-5-imino-2-phenyl-4-(phenylhydrazinylidene)oxolan-3-ylidene]amino]aniline.
| Compound Name | N-[(E)-[(2S,4E)-5-imino-2-phenyl-4-(phenylhydrazinylidene)oxolan-3-ylidene]amino]aniline |
|---|---|
| PubChem CID | 92641131 |
| Molecular Formula | C22H19N5O |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | N-[(E)-[(2S,4E)-5-imino-2-phenyl-4-(phenylhydrazinylidene)oxolan-3-ylidene]amino]aniline |
| SMILES | [H]/N=C1\O[C@@H](c2ccccc2)C(=N/Nc2ccccc2)/C1=N\Nc1ccccc1 |
| InChI | InChI=1S/C22H19N5O/c23-22-20(27-25-18-14-8-3-9-15-18)19(26-24-17-12-6-2-7-13-17)21(28-22)16-10-4-1-5-11-16/h1-15,21,23-25H/b23-22-,26-19+,27-20+/t21-/m0/s1 |
| InChIKey | FJAMSOBELZNVFN-XVFZJMAOSA-N |
| XLogP | 4.67 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|