C9H10N6O2S — CID 6399293
(4Z)-1-hydroxy-5-imino-1-oxo-4-(phenylhydrazinylidene)-1λ6-thia-2,6-diazacyclohexa-2,6-dien-3-amine (PubChem CID 6399293) has the molecular formula C9H10N6O2S and a molecular weight of 266.29 g/mol. Its IUPAC name is (4Z)-1-hydroxy-5-imino-1-oxo-4-(phenylhydrazinylidene)-1λ6-thia-2,6-diazacyclohexa-2,6-dien-3-amine.
| Compound Name | (4Z)-1-hydroxy-5-imino-1-oxo-4-(phenylhydrazinylidene)-1λ6-thia-2,6-diazacyclohexa-2,6-dien-3-amine |
|---|---|
| PubChem CID | 6399293 |
| Molecular Formula | C9H10N6O2S |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | (4Z)-1-hydroxy-5-imino-1-oxo-4-(phenylhydrazinylidene)-1λ6-thia-2,6-diazacyclohexa-2,6-dien-3-amine |
| SMILES | [H]/N=C1\N=S(=O)(O)N=C(N)\C1=N\Nc1ccccc1 |
| InChI | InChI=1S/C9H10N6O2S/c10-8-7(9(11)15-18(16,17)14-8)13-12-6-4-2-1-3-5-6/h1-5,12H,(H4,10,11,14,15,16,17) |
| InChIKey | UWLFXXHHLJJRJZ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 136.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|