C13H12N2O2S2 — CID 20850749
N-[(E)-(1,1-dioxo-2,3-dihydrothieno[2,3-b]thiopyran-4-ylidene)amino]aniline (PubChem CID 20850749) has the molecular formula C13H12N2O2S2 and a molecular weight of 292.38 g/mol. Its IUPAC name is N-[(E)-(1,1-dioxo-2,3-dihydrothieno[2,3-b]thiopyran-4-ylidene)amino]aniline.
| Compound Name | N-[(E)-(1,1-dioxo-2,3-dihydrothieno[2,3-b]thiopyran-4-ylidene)amino]aniline |
|---|---|
| PubChem CID | 20850749 |
| Molecular Formula | C13H12N2O2S2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | N-[(E)-(1,1-dioxo-2,3-dihydrothieno[2,3-b]thiopyran-4-ylidene)amino]aniline |
| SMILES | O=S1(=O)CCc2c1scc/c2=N\Nc1ccccc1 |
| InChI | InChI=1S/C13H12N2O2S2/c16-19(17)9-7-11-12(6-8-18-13(11)19)15-14-10-4-2-1-3-5-10/h1-6,8,14H,7,9H2/b15-12+ |
| InChIKey | CAXQOYQKOCKCJI-NTCAYCPXSA-N |
| XLogP | 2.01 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|