C22H17N5O6 — CID 6821628
4-[2-[4-[(4-carboxyphenyl)hydrazinylidene]-2-(furan-2-yl)-5-iminooxolan-3-ylidene]hydrazinyl]benzoic acid (PubChem CID 6821628) has the molecular formula C22H17N5O6 and a molecular weight of 447.41 g/mol. Its IUPAC name is 4-[2-[4-[(4-carboxyphenyl)hydrazinylidene]-2-(furan-2-yl)-5-iminooxolan-3-ylidene]hydrazinyl]benzoic acid.
| Compound Name | 4-[2-[4-[(4-carboxyphenyl)hydrazinylidene]-2-(furan-2-yl)-5-iminooxolan-3-ylidene]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 6821628 |
| Molecular Formula | C22H17N5O6 |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | 4-[2-[4-[(4-carboxyphenyl)hydrazinylidene]-2-(furan-2-yl)-5-iminooxolan-3-ylidene]hydrazinyl]benzoic acid |
| SMILES | [H]/N=C1\OC(c2ccco2)C(=NNc2ccc(C(=O)O)cc2)C1=NNc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C22H17N5O6/c23-20-18(27-25-15-9-5-13(6-10-15)22(30)31)17(19(33-20)16-2-1-11-32-16)26-24-14-7-3-12(4-8-14)21(28)29/h1-11,19,23-25H,(H,28,29)(H,30,31)/b23-20-,26-17?,27-18? |
| InChIKey | SQWRMBBDXNYSNS-UHUIKBAKSA-N |
| XLogP | 3.66 |
| TPSA | 169.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|