4-[2-(1,3-dihydroinden-2-ylidene)hydrazinyl]benzoic acid

C16H14N2O2 — CID 9013359

IUPAC4-[2-(1,3-dihydroinden-2-ylidene)hydrazinyl]benzoic acid
SMILESO=C(O)c1ccc(NN=C2Cc3ccccc3C2)cc1
InChIInChI=1S/C16H14N2O2/c19-16(20)11-5-7-14(8-6-11)17-18-15-9-12-3-1-2-4-13(12)10-15/h1-8,17H,9-10H2,(H,19,20)
InChIKeyJWUUUHCSHNLFAH-UHFFFAOYSA-N
MW266.30 g/mol
LogP2.95
Rot. Bonds3

About 4-[2-(1,3-dihydroinden-2-ylidene)hydrazinyl]benzoic acid

4-[2-(1,3-dihydroinden-2-ylidene)hydrazinyl]benzoic acid (PubChem CID 9013359) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 4-[2-(1,3-dihydroinden-2-ylidene)hydrazinyl]benzoic acid.

Molecular Properties

Compound Name4-[2-(1,3-dihydroinden-2-ylidene)hydrazinyl]benzoic acid
PubChem CID9013359
Molecular FormulaC16H14N2O2
Molecular Weight266.30 g/mol
Exact Mass266.11
IUPAC Name4-[2-(1,3-dihydroinden-2-ylidene)hydrazinyl]benzoic acid
SMILESO=C(O)c1ccc(NN=C2Cc3ccccc3C2)cc1
InChIInChI=1S/C16H14N2O2/c19-16(20)11-5-7-14(8-6-11)17-18-15-9-12-3-1-2-4-13(12)10-15/h1-8,17H,9-10H2,(H,19,20)
InChIKeyJWUUUHCSHNLFAH-UHFFFAOYSA-N
XLogP2.95
TPSA61.69 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.30
LogP ≤ 52.95
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 4-[2-(1,3-dihydroinden-2-ylidene)hydrazinyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[2-(1,3-dihydroinden-2-ylidene)hydrazinyl]benzoic acid?
The IUPAC name of 4-[2-(1,3-dihydroinden-2-ylidene)hydrazinyl]benzoic acid (CID 9013359) is 4-[2-(1,3-dihydroinden-2-ylidene)hydrazinyl]benzoic acid.
What is the SMILES notation for 4-[2-(1,3-dihydroinden-2-ylidene)hydrazinyl]benzoic acid?
The canonical SMILES for 4-[2-(1,3-dihydroinden-2-ylidene)hydrazinyl]benzoic acid is O=C(O)c1ccc(NN=C2Cc3ccccc3C2)cc1.
What is the InChIKey of 4-[2-(1,3-dihydroinden-2-ylidene)hydrazinyl]benzoic acid?
The InChIKey is JWUUUHCSHNLFAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O2/c19-16(20)11-5-7-14(8-6-11)17-18-15-9-12-3-1-2-4-13(12)10-15/h1-8,17H,9-10H2,(H,19,20).
What are the key properties of 4-[2-(1,3-dihydroinden-2-ylidene)hydrazinyl]benzoic acid?
4-[2-(1,3-dihydroinden-2-ylidene)hydrazinyl]benzoic acid has a molecular weight of 266.30 g/mol, XLogP of 2.95, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(1,3-dihydroinden-2-ylidene)hydrazinyl]benzoic acid is sourced from PubChem (CID 9013359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).