C16H14N2O2 — CID 9013359
4-[2-(1,3-dihydroinden-2-ylidene)hydrazinyl]benzoic acid (PubChem CID 9013359) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 4-[2-(1,3-dihydroinden-2-ylidene)hydrazinyl]benzoic acid.
| Compound Name | 4-[2-(1,3-dihydroinden-2-ylidene)hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 9013359 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 4-[2-(1,3-dihydroinden-2-ylidene)hydrazinyl]benzoic acid |
| SMILES | O=C(O)c1ccc(NN=C2Cc3ccccc3C2)cc1 |
| InChI | InChI=1S/C16H14N2O2/c19-16(20)11-5-7-14(8-6-11)17-18-15-9-12-3-1-2-4-13(12)10-15/h1-8,17H,9-10H2,(H,19,20) |
| InChIKey | JWUUUHCSHNLFAH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|