C16H13N2O2- — CID 9013358
4-[2-(1,3-dihydroinden-2-ylidene)hydrazinyl]benzoate (PubChem CID 9013358) has the molecular formula C16H13N2O2- and a molecular weight of 265.29 g/mol. Its IUPAC name is 4-[2-(1,3-dihydroinden-2-ylidene)hydrazinyl]benzoate.
| Compound Name | 4-[2-(1,3-dihydroinden-2-ylidene)hydrazinyl]benzoate |
|---|---|
| PubChem CID | 9013358 |
| Molecular Formula | C16H13N2O2- |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 4-[2-(1,3-dihydroinden-2-ylidene)hydrazinyl]benzoate |
| SMILES | O=C([O-])c1ccc(NN=C2Cc3ccccc3C2)cc1 |
| InChI | InChI=1S/C16H14N2O2/c19-16(20)11-5-7-14(8-6-11)17-18-15-9-12-3-1-2-4-13(12)10-15/h1-8,17H,9-10H2,(H,19,20)/p-1 |
| InChIKey | JWUUUHCSHNLFAH-UHFFFAOYSA-M |
| XLogP | 1.62 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|