C34H18CuN4O10 — CID 46854578
copper bis(4-[(2Z)-2-(1,3,4-trioxonaphthalen-2-ylidene)hydrazinyl]benzoate) (PubChem CID 46854578) has the molecular formula C34H18CuN4O10 and a molecular weight of 706.08 g/mol. Its IUPAC name is copper bis(4-[(2Z)-2-(1,3,4-trioxonaphthalen-2-ylidene)hydrazinyl]benzoate).
| Compound Name | copper bis(4-[(2Z)-2-(1,3,4-trioxonaphthalen-2-ylidene)hydrazinyl]benzoate) |
|---|---|
| PubChem CID | 46854578 |
| Molecular Formula | C34H18CuN4O10 |
| Molecular Weight | 706.08 g/mol |
| Exact Mass | 705.03 |
| IUPAC Name | copper bis(4-[(2Z)-2-(1,3,4-trioxonaphthalen-2-ylidene)hydrazinyl]benzoate) |
| SMILES | O=C([O-])c1ccc(N/N=c2\c(=O)c(=O)c3ccccc3c2=O)cc1.O=C([O-])c1ccc(N/N=c2\c(=O)c(=O)c3ccccc3c2=O)cc1.[Cu+2] |
| InChI | InChI=1S/2C17H10N2O5.Cu/c2*20-14-11-3-1-2-4-12(11)15(21)16(22)13(14)19-18-10-7-5-9(6-8-10)17(23)24;/h2*1-8,18H,(H,23,24);/q;;+2/p-2/b2*19-13-; |
| InChIKey | MAYZCPAWWDTFCL-NYNYGYKOSA-L |
| XLogP | -1.83 |
| TPSA | 231.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.08 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|