C20H15FN2O3 — CID 166377678
6-(5-fluoro-1-methylindol-3-yl)-8-methyl-4-oxo-1H-quinoline-3-carboxylic acid (PubChem CID 166377678) has the molecular formula C20H15FN2O3 and a molecular weight of 350.35 g/mol. Its IUPAC name is 6-(5-fluoro-1-methylindol-3-yl)-8-methyl-4-oxo-1H-quinoline-3-carboxylic acid.
| Compound Name | 6-(5-fluoro-1-methylindol-3-yl)-8-methyl-4-oxo-1H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 166377678 |
| Molecular Formula | C20H15FN2O3 |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 6-(5-fluoro-1-methylindol-3-yl)-8-methyl-4-oxo-1H-quinoline-3-carboxylic acid |
| SMILES | Cc1cc(-c2cn(C)c3ccc(F)cc23)cc2c(=O)c(C(=O)O)c[nH]c12 |
| InChI | InChI=1S/C20H15FN2O3/c1-10-5-11(6-14-18(10)22-8-15(19(14)24)20(25)26)16-9-23(2)17-4-3-12(21)7-13(16)17/h3-9H,1-2H3,(H,22,24)(H,25,26) |
| InChIKey | BYDMKYZSRPYODH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |