C20H21IN2O3 — CID 166377747
2-[[4-(4-iodophenyl)-4-oxobutanoyl]amino]-3-phenylbutanamide (PubChem CID 166377747) has the molecular formula C20H21IN2O3 and a molecular weight of 464.30 g/mol. Its IUPAC name is 2-[[4-(4-iodophenyl)-4-oxobutanoyl]amino]-3-phenylbutanamide.
| Compound Name | 2-[[4-(4-iodophenyl)-4-oxobutanoyl]amino]-3-phenylbutanamide |
|---|---|
| PubChem CID | 166377747 |
| Molecular Formula | C20H21IN2O3 |
| Molecular Weight | 464.30 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | 2-[[4-(4-iodophenyl)-4-oxobutanoyl]amino]-3-phenylbutanamide |
| SMILES | CC(c1ccccc1)C(NC(=O)CCC(=O)c1ccc(I)cc1)C(N)=O |
| InChI | InChI=1S/C20H21IN2O3/c1-13(14-5-3-2-4-6-14)19(20(22)26)23-18(25)12-11-17(24)15-7-9-16(21)10-8-15/h2-10,13,19H,11-12H2,1H3,(H2,22,26)(H,23,25) |
| InChIKey | UAXCYWPIFDARLK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|