C19H20INO4 — CID 166378252
(2R)-2-[[3-[(4-iodophenoxy)methyl]benzoyl]amino]-3-methylbutanoic acid (PubChem CID 166378252) has the molecular formula C19H20INO4 and a molecular weight of 453.28 g/mol. Its IUPAC name is (2R)-2-[[3-[(4-iodophenoxy)methyl]benzoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[[3-[(4-iodophenoxy)methyl]benzoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 166378252 |
| Molecular Formula | C19H20INO4 |
| Molecular Weight | 453.28 g/mol |
| Exact Mass | 453.04 |
| IUPAC Name | (2R)-2-[[3-[(4-iodophenoxy)methyl]benzoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](NC(=O)c1cccc(COc2ccc(I)cc2)c1)C(=O)O |
| InChI | InChI=1S/C19H20INO4/c1-12(2)17(19(23)24)21-18(22)14-5-3-4-13(10-14)11-25-16-8-6-15(20)7-9-16/h3-10,12,17H,11H2,1-2H3,(H,21,22)(H,23,24)/t17-/m1/s1 |
| InChIKey | OQDKGPKVTLODKL-QGZVFWFLSA-N |
| XLogP | 3.71 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.28 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|