C27H25FN4O4S — CID 166378934
1-[2-[4-(3-cyanopropylsulfonyl)benzoyl]-3,4-dihydro-1H-isoquinolin-5-yl]-3-(2-fluorophenyl)urea (PubChem CID 166378934) has the molecular formula C27H25FN4O4S and a molecular weight of 520.59 g/mol. Its IUPAC name is 1-[2-[4-(3-cyanopropylsulfonyl)benzoyl]-3,4-dihydro-1H-isoquinolin-5-yl]-3-(2-fluorophenyl)urea.
| Compound Name | 1-[2-[4-(3-cyanopropylsulfonyl)benzoyl]-3,4-dihydro-1H-isoquinolin-5-yl]-3-(2-fluorophenyl)urea |
|---|---|
| PubChem CID | 166378934 |
| Molecular Formula | C27H25FN4O4S |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | 1-[2-[4-(3-cyanopropylsulfonyl)benzoyl]-3,4-dihydro-1H-isoquinolin-5-yl]-3-(2-fluorophenyl)urea |
| SMILES | N#CCCCS(=O)(=O)c1ccc(C(=O)N2CCc3c(cccc3NC(=O)Nc3ccccc3F)C2)cc1 |
| InChI | InChI=1S/C27H25FN4O4S/c28-23-7-1-2-8-25(23)31-27(34)30-24-9-5-6-20-18-32(16-14-22(20)24)26(33)19-10-12-21(13-11-19)37(35,36)17-4-3-15-29/h1-2,5-13H,3-4,14,16-18H2,(H2,30,31,34) |
| InChIKey | FGFOUQRJUMCPIF-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 119.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|