C21H26N4O2 — CID 166382150
7-[(2-hexoxy-4-methylphenyl)methylamino]-3H-pyrido[2,3-d]pyrimidin-4-one (PubChem CID 166382150) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is 7-[(2-hexoxy-4-methylphenyl)methylamino]-3H-pyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 7-[(2-hexoxy-4-methylphenyl)methylamino]-3H-pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 166382150 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 7-[(2-hexoxy-4-methylphenyl)methylamino]-3H-pyrido[2,3-d]pyrimidin-4-one |
| SMILES | CCCCCCOc1cc(C)ccc1CNc1ccc2c(=O)[nH]cnc2n1 |
| InChI | InChI=1S/C21H26N4O2/c1-3-4-5-6-11-27-18-12-15(2)7-8-16(18)13-22-19-10-9-17-20(25-19)23-14-24-21(17)26/h7-10,12,14H,3-6,11,13H2,1-2H3,(H2,22,23,24,25,26) |
| InChIKey | HSMJMRQGIRNORV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|