C20H27N3O2 — CID 166382202
N-[(2-hexoxy-4-methylphenyl)methyl]-5,7-dihydrofuro[3,4-d]pyrimidin-2-amine (PubChem CID 166382202) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is N-[(2-hexoxy-4-methylphenyl)methyl]-5,7-dihydrofuro[3,4-d]pyrimidin-2-amine.
| Compound Name | N-[(2-hexoxy-4-methylphenyl)methyl]-5,7-dihydrofuro[3,4-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 166382202 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | N-[(2-hexoxy-4-methylphenyl)methyl]-5,7-dihydrofuro[3,4-d]pyrimidin-2-amine |
| SMILES | CCCCCCOc1cc(C)ccc1CNc1ncc2c(n1)COC2 |
| InChI | InChI=1S/C20H27N3O2/c1-3-4-5-6-9-25-19-10-15(2)7-8-16(19)11-21-20-22-12-17-13-24-14-18(17)23-20/h7-8,10,12H,3-6,9,11,13-14H2,1-2H3,(H,21,22,23) |
| InChIKey | LIRQDOXCLMPGLR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|