C17H26N6O — CID 166382170
2-N-[(2-hexoxy-4-methylphenyl)methyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 166382170) has the molecular formula C17H26N6O and a molecular weight of 330.44 g/mol. Its IUPAC name is 2-N-[(2-hexoxy-4-methylphenyl)methyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[(2-hexoxy-4-methylphenyl)methyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 166382170 |
| Molecular Formula | C17H26N6O |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | 2-N-[(2-hexoxy-4-methylphenyl)methyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCCCOc1cc(C)ccc1CNc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C17H26N6O/c1-3-4-5-6-9-24-14-10-12(2)7-8-13(14)11-20-17-22-15(18)21-16(19)23-17/h7-8,10H,3-6,9,11H2,1-2H3,(H5,18,19,20,21,22,23) |
| InChIKey | NWENFHNSIIUPRO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|