C22H30N2O3 — CID 166382734
N'-(3,5-dimethoxyphenyl)-N-(1-methoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-yl)ethane-1,2-diamine (PubChem CID 166382734) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is N'-(3,5-dimethoxyphenyl)-N-(1-methoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-yl)ethane-1,2-diamine.
| Compound Name | N'-(3,5-dimethoxyphenyl)-N-(1-methoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 166382734 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | N'-(3,5-dimethoxyphenyl)-N-(1-methoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-yl)ethane-1,2-diamine |
| SMILES | COc1cc(NCCNC2CCCc3c(cccc3OC)C2)cc(OC)c1 |
| InChI | InChI=1S/C22H30N2O3/c1-25-19-13-18(14-20(15-19)26-2)24-11-10-23-17-7-5-8-21-16(12-17)6-4-9-22(21)27-3/h4,6,9,13-15,17,23-24H,5,7-8,10-12H2,1-3H3 |
| InChIKey | NWBXLEVAOFLHAY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|