C16H15N3O5S — CID 166383650
methyl 3-(2-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carbonyl)-5-nitrobenzoate (PubChem CID 166383650) has the molecular formula C16H15N3O5S and a molecular weight of 361.38 g/mol. Its IUPAC name is methyl 3-(2-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carbonyl)-5-nitrobenzoate.
| Compound Name | methyl 3-(2-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carbonyl)-5-nitrobenzoate |
|---|---|
| PubChem CID | 166383650 |
| Molecular Formula | C16H15N3O5S |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | methyl 3-(2-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carbonyl)-5-nitrobenzoate |
| SMILES | COC(=O)c1cc(C(=O)N2CCc3nc(C)sc3C2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H15N3O5S/c1-9-17-13-3-4-18(8-14(13)25-9)15(20)10-5-11(16(21)24-2)7-12(6-10)19(22)23/h5-7H,3-4,8H2,1-2H3 |
| InChIKey | IELQGBTXSUZSAO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 102.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|