C18H18BrN3O3S — CID 166383774
N-[5-[(3-bromophenyl)methyl]-1,3-thiazol-2-yl]-2-(2,5-dioxopyrrolidin-1-yl)butanamide (PubChem CID 166383774) has the molecular formula C18H18BrN3O3S and a molecular weight of 436.33 g/mol. Its IUPAC name is N-[5-[(3-bromophenyl)methyl]-1,3-thiazol-2-yl]-2-(2,5-dioxopyrrolidin-1-yl)butanamide.
| Compound Name | N-[5-[(3-bromophenyl)methyl]-1,3-thiazol-2-yl]-2-(2,5-dioxopyrrolidin-1-yl)butanamide |
|---|---|
| PubChem CID | 166383774 |
| Molecular Formula | C18H18BrN3O3S |
| Molecular Weight | 436.33 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | N-[5-[(3-bromophenyl)methyl]-1,3-thiazol-2-yl]-2-(2,5-dioxopyrrolidin-1-yl)butanamide |
| SMILES | CCC(C(=O)Nc1ncc(Cc2cccc(Br)c2)s1)N1C(=O)CCC1=O |
| InChI | InChI=1S/C18H18BrN3O3S/c1-2-14(22-15(23)6-7-16(22)24)17(25)21-18-20-10-13(26-18)9-11-4-3-5-12(19)8-11/h3-5,8,10,14H,2,6-7,9H2,1H3,(H,20,21,25) |
| InChIKey | IPHHJMTUGKKWJY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|