C18H15FN4O — CID 166384198
(6-fluoroisoquinolin-4-yl)-(2-pyrimidin-4-ylpyrrolidin-1-yl)methanone (PubChem CID 166384198) has the molecular formula C18H15FN4O and a molecular weight of 322.34 g/mol. Its IUPAC name is (6-fluoroisoquinolin-4-yl)-(2-pyrimidin-4-ylpyrrolidin-1-yl)methanone.
| Compound Name | (6-fluoroisoquinolin-4-yl)-(2-pyrimidin-4-ylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 166384198 |
| Molecular Formula | C18H15FN4O |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | (6-fluoroisoquinolin-4-yl)-(2-pyrimidin-4-ylpyrrolidin-1-yl)methanone |
| SMILES | O=C(c1cncc2ccc(F)cc12)N1CCCC1c1ccncn1 |
| InChI | InChI=1S/C18H15FN4O/c19-13-4-3-12-9-21-10-15(14(12)8-13)18(24)23-7-1-2-17(23)16-5-6-20-11-22-16/h3-6,8-11,17H,1-2,7H2 |
| InChIKey | FOOSROHUQLDOMG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |