C10H17NO2S — CID 16638717
tert-butyl 2-thia-5-azabicyclo[2.2.1]heptane-5-carboxylate (PubChem CID 16638717) has the molecular formula C10H17NO2S and a molecular weight of 215.32 g/mol. Its IUPAC name is tert-butyl 2-thia-5-azabicyclo[2.2.1]heptane-5-carboxylate.
| Compound Name | tert-butyl 2-thia-5-azabicyclo[2.2.1]heptane-5-carboxylate |
|---|---|
| PubChem CID | 16638717 |
| Molecular Formula | C10H17NO2S |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | tert-butyl 2-thia-5-azabicyclo[2.2.1]heptane-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CC1CS2 |
| InChI | InChI=1S/C10H17NO2S/c1-10(2,3)13-9(12)11-5-8-4-7(11)6-14-8/h7-8H,4-6H2,1-3H3 |
| InChIKey | VOTMFZVJNCZQTO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |