C16H12F2O3S — CID 166387621
2,2-difluoro-4-(4-methylsulfonylphenyl)-3H-inden-1-one (PubChem CID 166387621) has the molecular formula C16H12F2O3S and a molecular weight of 322.33 g/mol. Its IUPAC name is 2,2-difluoro-4-(4-methylsulfonylphenyl)-3H-inden-1-one.
| Compound Name | 2,2-difluoro-4-(4-methylsulfonylphenyl)-3H-inden-1-one |
|---|---|
| PubChem CID | 166387621 |
| Molecular Formula | C16H12F2O3S |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 2,2-difluoro-4-(4-methylsulfonylphenyl)-3H-inden-1-one |
| SMILES | CS(=O)(=O)c1ccc(-c2cccc3c2CC(F)(F)C3=O)cc1 |
| InChI | InChI=1S/C16H12F2O3S/c1-22(20,21)11-7-5-10(6-8-11)12-3-2-4-13-14(12)9-16(17,18)15(13)19/h2-8H,9H2,1H3 |
| InChIKey | IPDQMXNAPFAEOW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |