C13H19N3O5S — CID 166388078
(3R)-3-[[4-(ethylsulfamoylamino)benzoyl]amino]butanoic acid (PubChem CID 166388078) has the molecular formula C13H19N3O5S and a molecular weight of 329.38 g/mol. Its IUPAC name is (3R)-3-[[4-(ethylsulfamoylamino)benzoyl]amino]butanoic acid.
| Compound Name | (3R)-3-[[4-(ethylsulfamoylamino)benzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 166388078 |
| Molecular Formula | C13H19N3O5S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | (3R)-3-[[4-(ethylsulfamoylamino)benzoyl]amino]butanoic acid |
| SMILES | CCNS(=O)(=O)Nc1ccc(C(=O)N[C@H](C)CC(=O)O)cc1 |
| InChI | InChI=1S/C13H19N3O5S/c1-3-14-22(20,21)16-11-6-4-10(5-7-11)13(19)15-9(2)8-12(17)18/h4-7,9,14,16H,3,8H2,1-2H3,(H,15,19)(H,17,18)/t9-/m1/s1 |
| InChIKey | ZQCYQRRMEFZTAF-SECBINFHSA-N |
| XLogP | 0.55 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |