C21H24N2O6S — CID 46819650
[1-[4-(methanesulfonamido)phenyl]-1-oxopropan-2-yl] 3-benzamidobutanoate (PubChem CID 46819650) has the molecular formula C21H24N2O6S and a molecular weight of 432.50 g/mol. Its IUPAC name is [1-[4-(methanesulfonamido)phenyl]-1-oxopropan-2-yl] 3-benzamidobutanoate.
| Compound Name | [1-[4-(methanesulfonamido)phenyl]-1-oxopropan-2-yl] 3-benzamidobutanoate |
|---|---|
| PubChem CID | 46819650 |
| Molecular Formula | C21H24N2O6S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | [1-[4-(methanesulfonamido)phenyl]-1-oxopropan-2-yl] 3-benzamidobutanoate |
| SMILES | CC(CC(=O)OC(C)C(=O)c1ccc(NS(C)(=O)=O)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H24N2O6S/c1-14(22-21(26)17-7-5-4-6-8-17)13-19(24)29-15(2)20(25)16-9-11-18(12-10-16)23-30(3,27)28/h4-12,14-15,23H,13H2,1-3H3,(H,22,26) |
| InChIKey | FPVHGJWIRBIGOC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |