C19H19F2NO6S — CID 55386201
[1-[4-(methanesulfonamido)phenyl]-1-oxopropan-2-yl] 2-[4-(difluoromethoxy)phenyl]acetate (PubChem CID 55386201) has the molecular formula C19H19F2NO6S and a molecular weight of 427.43 g/mol. Its IUPAC name is [1-[4-(methanesulfonamido)phenyl]-1-oxopropan-2-yl] 2-[4-(difluoromethoxy)phenyl]acetate.
| Compound Name | [1-[4-(methanesulfonamido)phenyl]-1-oxopropan-2-yl] 2-[4-(difluoromethoxy)phenyl]acetate |
|---|---|
| PubChem CID | 55386201 |
| Molecular Formula | C19H19F2NO6S |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | [1-[4-(methanesulfonamido)phenyl]-1-oxopropan-2-yl] 2-[4-(difluoromethoxy)phenyl]acetate |
| SMILES | CC(OC(=O)Cc1ccc(OC(F)F)cc1)C(=O)c1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C19H19F2NO6S/c1-12(18(24)14-5-7-15(8-6-14)22-29(2,25)26)27-17(23)11-13-3-9-16(10-4-13)28-19(20)21/h3-10,12,19,22H,11H2,1-2H3 |
| InChIKey | YFDRZCXSDNEBTH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |